cas: 7464-14-4 — see every product listed under this CAS number, including other names
2-Hydroxy-5-methyl-3-nitropyridine 98% (CAS 7464-14-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121395-5g |
| cas | 7464-14-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 464.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121395 |
5-methyl-3-nitro-1H-pyridin-2-one (CAS 7464-14-4) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 5-methyl-3-nitro-1H-pyridin-2-one. InChIKey: QAINEQVHSHARMD-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 5-methyl-3-nitro-1H-pyridin-2-one |
| InChIKey | QAINEQVHSHARMD-UHFFFAOYSA-N |
| SMILES | CC1=CNC(=O)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)