Products 257932-29-9

CAS 257932-29-9 is the registry number for 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.

Structural formula: {0} (CAS {1})

2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid (CAS 257932-29-9) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: 2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid. InChIKey: FSQSHXLJRFYYMV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O3
Molecular weight170.21 g/mol
IUPAC name2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid
InChIKeyFSQSHXLJRFYYMV-UHFFFAOYSA-N
SMILESC1CC(C2CC1C(C2)C(=O)O)O

Computed by PubChem (NCBI)