2-Iodo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl, 95+%
cas: 1070663-76-1 — see every product listed under this CAS number, including other names
2-Iodo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl, 95+% (CAS 1070663-76-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F869284-100MG |
| cas | 1070663-76-1 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2261.62 Pln | |
| Ambeed | 25g | 7924.25 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 2718.80 Pln | |
| Chemat | 25g | 9352.40 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 758.65 Pln | |
| BLDpharm | 5g | 2430.28 Pln | |
| BLDpharm | 25g | 8539.24 Pln |
properties
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-iodo-1,4-dimethoxy-3-[2,4,6-tri(propan-2-yl)phenyl]benzene (CAS 1070663-76-1) is a chemical compound with the molecular formula C23H31IO2 and a molecular weight of 466.4 g/mol. IUPAC name: 2-iodo-1,4-dimethoxy-3-[2,4,6-tri(propan-2-yl)phenyl]benzene. InChIKey: LOUYGKSUFMSHGM-UHFFFAOYSA-N.
| Molecular formula | C23H31IO2 |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | 2-iodo-1,4-dimethoxy-3-[2,4,6-tri(propan-2-yl)phenyl]benzene |
| InChIKey | LOUYGKSUFMSHGM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=C(C=CC(=C2I)OC)OC)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-iodo-2',4',6'-triisopropyl-3,6-dimethoxybiphenyl, 2-Iodo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl, 2-iodo-1,4-dimethoxy-3-[2,4,6-tri(propan-2-yl)phenyl]benzene, 2-Iodo-3,6-dimethoxy-2',4',6'-tri-i-propyl-1,1'-biphenyl, 2-Iodo-3,6-dimethoxy-2',4',6'-tri-i-propyl-l,1-biphenyl, LOUYGKSUFMSHGM-UHFFFAOYSA-N, 2-iodo-1,4-dimethoxy-3-(2,4,6-triisopropylphenyl)benzene, 2-iodo-3,6-dimethoxy-2'4'6'-tri-i-propyl-l,1-biphenyl, 2-Iodo-3,6-dimethoxy-2',4',6'-tri(propan-2-yl)-1,1'-biphenyl