cas: 3710-23-4 — see every product listed under this CAS number, including other names
2-Isopropenylnaphthalene, >98.0%(GC) (CAS 3710-23-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0413-5G |
| cas | 3710-23-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 211.77 Pln | |
| TCI | 25g | 624.82 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-prop-1-en-2-ylnaphthalene (CAS 3710-23-4) is a chemical compound with the molecular formula C13H12 and a molecular weight of 168.23 g/mol. IUPAC name: 2-prop-1-en-2-ylnaphthalene. InChIKey: ANCUXNXTHQXICN-UHFFFAOYSA-N.
| Molecular formula | C13H12 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | 2-prop-1-en-2-ylnaphthalene |
| InChIKey | ANCUXNXTHQXICN-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)