cas: 213381-88-5 — see every product listed under this CAS number, including other names
2-METHYL-4-(4'-TERT-BUTYLPHENYL)INDENE, 97% (CAS 213381-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467206-250MG |
| cas | 213381-88-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1705.67 Pln | |
| Fluorochem | 25g | 8166.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-tert-butylphenyl)-2-methyl-1H-indene (CAS 213381-88-5) is a chemical compound with the molecular formula C20H22 and a molecular weight of 262.4 g/mol. IUPAC name: 4-(4-tert-butylphenyl)-2-methyl-1H-indene. InChIKey: FUDWOKXLGOJFFQ-UHFFFAOYSA-N.
| Molecular formula | C20H22 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)-2-methyl-1H-indene |
| InChIKey | FUDWOKXLGOJFFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)C=CC=C2C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)