cas: 1609393-90-9 — see every product listed under this CAS number, including other names
2-MEthoxy-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 95% (CAS 1609393-90-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A986099-50mg |
| cas | 1609393-90-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 392.62 Pln | |
| Ambeed | 100mg | 604.00 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 2484.12 Pln | |
| Ambeed | 5g | 9504.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A986099 |
2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1609393-90-9) is a chemical compound with the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. IUPAC name: 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: GTJCHAXQNVESRW-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO3 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | GTJCHAXQNVESRW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)N)OC |
Computed by PubChem (NCBI)