cas: 2127-09-5 — see every product listed under this CAS number, including other names
2-Mercapto-5-nitropyridine 95% (CAS 2127-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A817152-1g |
| cas | 2127-09-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 10g | 559.50 Pln | |
| Ambeed | 25g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A817152 |
5-nitro-1H-pyridine-2-thione (CAS 2127-09-5) is a chemical compound with the molecular formula C5H4N2O2S and a molecular weight of 156.16 g/mol. IUPAC name: 5-nitro-1H-pyridine-2-thione. InChIKey: BHQUBONFIYNJDA-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O2S |
|---|---|
| Molecular weight | 156.16 g/mol |
| IUPAC name | 5-nitro-1H-pyridine-2-thione |
| InChIKey | BHQUBONFIYNJDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)NC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)