cas: 886503-47-5 — see every product listed under this CAS number, including other names
2-Methoxy-4,6-bis(trifluoromethyl)benzoyl chloride, 95+% (CAS 886503-47-5) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A512932-10g |
| cas | 886503-47-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 5824.84 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methoxy-4,6-bis(trifluoromethyl)benzoyl chloride (CAS 886503-47-5) is a chemical compound with the molecular formula C10H5ClF6O2 and a molecular weight of 306.59 g/mol. IUPAC name: 2-methoxy-4,6-bis(trifluoromethyl)benzoyl chloride. InChIKey: JFIWHJKPNGEANU-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF6O2 |
|---|---|
| Molecular weight | 306.59 g/mol |
| IUPAC name | 2-methoxy-4,6-bis(trifluoromethyl)benzoyl chloride |
| InChIKey | JFIWHJKPNGEANU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1C(=O)Cl)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)