cas: 1150561-66-2 — see every product listed under this CAS number, including other names
2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine 95% (CAS 1150561-66-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A689899-250mg |
| cas | 1150561-66-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1738.75 Pln | |
| Ambeed | 1g | 3713.44 Pln | |
| Ambeed | 5g | 12096.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A689899 |
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine (CAS 1150561-66-2) is a chemical compound with the molecular formula C13H17BF3NO3 and a molecular weight of 303.09 g/mol. IUPAC name: 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine. InChIKey: DVHMQJFAZOPKQJ-UHFFFAOYSA-N.
| Molecular formula | C13H17BF3NO3 |
|---|---|
| Molecular weight | 303.09 g/mol |
| IUPAC name | 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine |
| InChIKey | DVHMQJFAZOPKQJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)OC)C(F)(F)F |
Computed by PubChem (NCBI)