Products 1451392-21-4

CAS 1451392-21-4 is the registry number for 2-Methoxy-4-(methylthio)pyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2-methoxy-4-methylsulfanyl-3-pyridinyl)boronic acid (CAS 1451392-21-4) is a chemical compound with the molecular formula C7H10BNO3S and a molecular weight of 199.04 g/mol. IUPAC name: (2-methoxy-4-methylsulfanyl-3-pyridinyl)boronic acid. InChIKey: UFJUIFDMXAHFSC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO3S
Molecular weight199.04 g/mol
IUPAC name(2-methoxy-4-methylsulfanyl-3-pyridinyl)boronic acid
InChIKeyUFJUIFDMXAHFSC-UHFFFAOYSA-N
SMILESB(C1=C(C=CN=C1OC)SC)(O)O

Computed by PubChem (NCBI)