cas: 64507-07-9 — see every product listed under this CAS number, including other names
2-Methoxy-5-(trifluoromethyl)benzoyl chloride 95% (CAS 64507-07-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A781184-1g |
| cas | 64507-07-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 492.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A781184 |
2-methoxy-5-(trifluoromethyl)benzoyl chloride (CAS 64507-07-9) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethyl)benzoyl chloride. InChIKey: YRNOLZJRZSOMLM-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O2 |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | YRNOLZJRZSOMLM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)