cas: 95041-90-0 — see every product listed under this CAS number, including other names
2-Methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol (CAS 95041-90-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F865972-25MG |
| cas | 95041-90-0 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 1138.16 Pln | |
| Fluorochem | 50mg | 1466.17 Pln | |
| Fluorochem | 100mg | 2101.36 Pln | |
| Fluorochem | 250mg | 3314.48 Pln |
| delivery time | 3-4 weeks |
|---|
2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol (CAS 95041-90-0) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol. InChIKey: UXDFUVFNIAJEGM-UHFFFAOYSA-N.
| Molecular formula | C18H22O5 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol |
| InChIKey | UXDFUVFNIAJEGM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCC2=CC(=C(C(=C2)OC)OC)OC)O |
Computed by PubChem (NCBI)