cas: 5446-92-4 — see every product listed under this CAS number, including other names
2-Methoxy-5-nitropyridine, 99%, 99% (CAS 5446-92-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0QI-5g |
| cas | 5446-92-4 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 165.20 Pln | |
| Chemat | 500g | 614.40 Pln | |
| Chemat | 1kg | 1010.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-5-nitropyridine (CAS 5446-92-4) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 2-methoxy-5-nitropyridine. InChIKey: WUPLOZFIOAEYMG-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 2-methoxy-5-nitropyridine |
| InChIKey | WUPLOZFIOAEYMG-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)