cas: 944904-45-4 — see every product listed under this CAS number, including other names
2-Methoxy-6-(trifluoromethyl)nicotinaldehyde, 98%, 98% (CAS 944904-45-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLIK-100mg |
| cas | 944904-45-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 1g | 1264.40 Pln | |
| Chemat | 5g | 4034.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-6-(trifluoromethyl)pyridine-3-carbaldehyde (CAS 944904-45-4) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 2-methoxy-6-(trifluoromethyl)pyridine-3-carbaldehyde. InChIKey: ITDCUBMBTZMYCC-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 2-methoxy-6-(trifluoromethyl)pyridine-3-carbaldehyde |
| InChIKey | ITDCUBMBTZMYCC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)