cas: 67192-42-1 — see every product listed under this CAS number, including other names
2-Methyl-1-nitro-4-(trifluoromethyl)benzene, ≥97%, ≥97% (CAS 67192-42-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAQQ-250mg |
| cas | 67192-42-1 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 1682.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-1-nitro-4-(trifluoromethyl)benzene (CAS 67192-42-1) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 2-methyl-1-nitro-4-(trifluoromethyl)benzene. InChIKey: PCCXJSOGGOWRJC-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 2-methyl-1-nitro-4-(trifluoromethyl)benzene |
| InChIKey | PCCXJSOGGOWRJC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)