Products 1190318-13-8
CAS 1190318-13-8 is the registry number for 2-METHYL-1H-PYRROLO[3,2-B]PYRIDINE-5-CARBONITRILE, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile (CAS 1190318-13-8) is a chemical compound with the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. IUPAC name: 2-methyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile. InChIKey: UKXBDAPEDODBPG-UHFFFAOYSA-N.
| Molecular formula | C9H7N3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 2-methyl-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile |
| InChIKey | UKXBDAPEDODBPG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=N2)C#N |
Computed by PubChem (NCBI)