cas: 2095779-29-4 — see every product listed under this CAS number, including other names
2-Methyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanenitrile 95% (CAS 2095779-29-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A125561-250mg |
| cas | 2095779-29-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 904.38 Pln | |
| Ambeed | 5g | 3196.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A125561 |
2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanenitrile (CAS 2095779-29-4) is a chemical compound with the molecular formula C13H20BN3O2 and a molecular weight of 261.13 g/mol. IUPAC name: 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanenitrile. InChIKey: XOTRSRMFBGJSFW-UHFFFAOYSA-N.
| Molecular formula | C13H20BN3O2 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanenitrile |
| InChIKey | XOTRSRMFBGJSFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)(C)C#N |
Computed by PubChem (NCBI)