2-Methyl-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-2,4-dihydro-3H-1,2,4-triazol-3-one, 95%
cas: 2924710-37-0 — see every product listed under this CAS number, including other names
2-Methyl-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-2,4-dihydro-3H-1,2,4-triazol-3-one, 95% (CAS 2924710-37-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2886746-1g |
| cas | 2924710-37-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 887.69 Pln | |
| Ambeed | 10g | 1460.62 Pln | |
| Ambeed | 25g | 2851.25 Pln | |
| Ambeed | 100g | 8964.44 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 953.02 Pln | |
| BLDpharm | 10g | 1569.47 Pln | |
| BLDpharm | 25g | 3068.94 Pln | |
| BLDpharm | 100g | 9661.07 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one (CAS 2924710-37-0) is a chemical compound with the molecular formula C15H20BN3O3 and a molecular weight of 301.15 g/mol. IUPAC name: 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one. InChIKey: NXKCEXHRTBAXTD-UHFFFAOYSA-N.
| Molecular formula | C15H20BN3O3 |
|---|---|
| Molecular weight | 301.15 g/mol |
| IUPAC name | 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one |
| InChIKey | NXKCEXHRTBAXTD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3C=NN(C3=O)C |
Computed by PubChem (NCBI)