2-Methyl-5-(trifluoromethoxy)-1h-indole, 95%
cas: 900182-99-2 — see every product listed under this CAS number, including other names
2-Methyl-5-(trifluoromethoxy)-1h-indole, 95% (CAS 900182-99-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-1997-1g |
| cas | 900182-99-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1432.81 Pln | |
| Ambeed | 5g | 5565.75 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1541.70 Pln | |
| BLDpharm | 5g | 5995.69 Pln | |
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 1g | 2334.80 Pln | |
| Chemat | 5g | 8008.40 Pln | |
| Fluorochem | 100mg | 1023.62 Pln | |
| Fluorochem | 250mg | 1669.22 Pln | |
| Fluorochem | 1g | 4324.54 Pln | |
| Fluorochem | 5g | 14617.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-methyl-5-(trifluoromethoxy)-1H-indole (CAS 900182-99-2) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: 2-methyl-5-(trifluoromethoxy)-1H-indole. InChIKey: LFVRFYLUTQMYHC-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethoxy)-1H-indole |
| InChIKey | LFVRFYLUTQMYHC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=C2)OC(F)(F)F |
Computed by PubChem (NCBI)