cas: 1030832-71-3 — see every product listed under this CAS number, including other names
2-Methyl-5-trifluoromethylphenylboronic acid, pinacol ester, 97%, 97% (CAS 1030832-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11058Z-100mg |
| cas | 1030832-71-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 1024.40 Pln | |
| Chemat | 25g | 2272.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[2-methyl-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 1030832-71-3) is a chemical compound with the molecular formula C14H18BF3O2 and a molecular weight of 286.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2-methyl-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: QZMBOYONRARSCJ-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2-methyl-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | QZMBOYONRARSCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)