cas: 1204580-79-9 — see every product listed under this CAS number, including other names
2-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole, 95%, 95% (CAS 1204580-79-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119U1E-250mg |
| cas | 1204580-79-9 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1509.20 Pln | |
| Chemat | 25g | 5027.60 Pln | |
| Chemat | 100mg | 107.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 1204580-79-9) is a chemical compound with the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. IUPAC name: 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: VHMKRODPCQSCKW-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2 |
|---|---|
| Molecular weight | 258.13 g/mol |
| IUPAC name | 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | VHMKRODPCQSCKW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NN(C=C3C=C2)C |
Computed by PubChem (NCBI)