cas: 845751-67-9 — see every product listed under this CAS number, including other names
2-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole, 97% (CAS 845751-67-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A582344-25g |
| cas | 845751-67-9 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 8578.57 Pln | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 500mg | 799.74 Pln | |
| Fluorochem | 1g | 1169.40 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 845751-67-9) is a chemical compound with the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. IUPAC name: 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: XDGGWHYHHVYGQE-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2 |
|---|---|
| Molecular weight | 258.13 g/mol |
| IUPAC name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | XDGGWHYHHVYGQE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC3=CN(N=C23)C |
Computed by PubChem (NCBI)