cas: 1628014-71-0 — see every product listed under this CAS number, including other names
2-Methyl-n-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)propan-2-amine, 98% (CAS 1628014-71-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694159-5G |
| cas | 1628014-71-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 825.77 Pln | |
| Fluorochem | 10g | 1382.86 Pln | |
| Fluorochem | 25g | 2694.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine (CAS 1628014-71-0) is a chemical compound with the molecular formula C17H28BNO2 and a molecular weight of 289.2 g/mol. IUPAC name: 2-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine. InChIKey: QJBWHEPPDGGWLQ-UHFFFAOYSA-N.
| Molecular formula | C17H28BNO2 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 2-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-2-amine |
| InChIKey | QJBWHEPPDGGWLQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CNC(C)(C)C |
Computed by PubChem (NCBI)