cas: 348086-68-0 — see every product listed under this CAS number, including other names
2-Methylamino-4-methylthiazole-5-sulfonamide, 97%, 97% (CAS 348086-68-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYJF-100mg |
| cas | 348086-68-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 500mg | 938.00 Pln | |
| Chemat | 1g | 1523.60 Pln | |
| Chemat | 5g | 5906.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-(methylamino)-1,3-thiazole-5-sulfonamide (CAS 348086-68-0) is a chemical compound with the molecular formula C5H9N3O2S2 and a molecular weight of 207.3 g/mol. IUPAC name: 4-methyl-2-(methylamino)-1,3-thiazole-5-sulfonamide. InChIKey: LVLDBZCFWNSVLJ-UHFFFAOYSA-N.
| Molecular formula | C5H9N3O2S2 |
|---|---|
| Molecular weight | 207.3 g/mol |
| IUPAC name | 4-methyl-2-(methylamino)-1,3-thiazole-5-sulfonamide |
| InChIKey | LVLDBZCFWNSVLJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC)S(=O)(=O)N |
Computed by PubChem (NCBI)