2-Methylnaphthalene-1-boronic Acid, 98%, 98%
cas: 103989-84-0 — see every product listed under this CAS number, including other names
2-Methylnaphthalene-1-boronic Acid, 98%, 98% (CAS 103989-84-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HPT-100mg |
| cas | 103989-84-0 |
| size | 100mg |
| availability | 125g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 1038.80 Pln | |
| Chemat | 10g | 1835.60 Pln | |
| Chemat | 25g | 4034.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-methylnaphthalen-1-yl)boronic acid (CAS 103989-84-0) is a chemical compound with the molecular formula C11H11BO2 and a molecular weight of 186.02 g/mol. IUPAC name: (2-methylnaphthalen-1-yl)boronic acid. InChIKey: RIZYBSMDFJDHOI-UHFFFAOYSA-N.
| Molecular formula | C11H11BO2 |
|---|---|
| Molecular weight | 186.02 g/mol |
| IUPAC name | (2-methylnaphthalen-1-yl)boronic acid |
| InChIKey | RIZYBSMDFJDHOI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=CC=CC=C12)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-methylnaphthalen-1-yl)boronic Acid, 2-methyl-1-naphthylboronic acid, 2-Methylnaphthalene-1-boronicAcid, 2-methyl-1-naphthalene boronic acid, (2-Methyl-1-naphthyl)boronic acid, Boronic acid, (2-methyl-1-naphthalenyl)-, 2-Methyl-1-naphthaleneboronic acid, 2-Methylnaphthalene-1-boronic Acid(contains varying amounts of Anhydride)