cas: 899828-53-6 — see every product listed under this CAS number, including other names
2-PRopanone, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime, 95%, 95% (CAS 899828-53-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ALO-25mg |
| cas | 899828-53-6 |
| size | 25mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 1096.40 Pln | |
| Chemat | 100mg | 1994.00 Pln | |
| Chemat | 250mg | 3774.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-2-imine (CAS 899828-53-6) is a chemical compound with the molecular formula C10H8F5NO and a molecular weight of 253.17 g/mol. IUPAC name: N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-2-imine. InChIKey: DLIFNTQMBOCKTL-UHFFFAOYSA-N.
| Molecular formula | C10H8F5NO |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-2-imine |
| InChIKey | DLIFNTQMBOCKTL-UHFFFAOYSA-N |
| SMILES | CC(=NOCC1=C(C(=C(C(=C1F)F)F)F)F)C |
Computed by PubChem (NCBI)