cas: 42607-21-6 — see every product listed under this CAS number, including other names
2-Phenyl-1,3-thiazolane-4-carboxylic acid, 95+%, 95+% (CAS 42607-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY6K-100mg |
| cas | 42607-21-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 323.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-phenyl-1,3-thiazolidine-4-carboxylic acid (CAS 42607-21-6) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 2-phenyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: AZDYQBFYMBALBY-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | AZDYQBFYMBALBY-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)