cas: 18547-93-8 — see every product listed under this CAS number, including other names
2-Propenoic acid,2-methyl-, 1,1'-[(1,1,3,3-tetramethyl-1,3-disiloxanediyl)di-3,1-propanediyl]ester, 97%, 97% (CAS 18547-93-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118TB3-250mg |
| cas | 18547-93-8 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 486.80 Pln | |
| Chemat | 25g | 918.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate (CAS 18547-93-8) is a chemical compound with the molecular formula C18H34O5Si2 and a molecular weight of 386.6 g/mol. IUPAC name: 3-[[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate. InChIKey: ZIFLDVXQTMSDJE-UHFFFAOYSA-N.
| Molecular formula | C18H34O5Si2 |
|---|---|
| Molecular weight | 386.6 g/mol |
| IUPAC name | 3-[[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| InChIKey | ZIFLDVXQTMSDJE-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(=C)C |
Computed by PubChem (NCBI)