cas: 1218791-47-9 — see every product listed under this CAS number, including other names
2-Propylaminopyrimidine-5-boronic acid, pinacol ester, 98%, 98% (CAS 1218791-47-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127BB-250mg |
| cas | 1218791-47-9 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 659.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1218791-47-9) is a chemical compound with the molecular formula C13H22BN3O2 and a molecular weight of 263.15 g/mol. IUPAC name: N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: AEZSUMXZKXWTDS-UHFFFAOYSA-N.
| Molecular formula | C13H22BN3O2 |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | AEZSUMXZKXWTDS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NCCC |
Computed by PubChem (NCBI)