cas: 91717-22-5 — see every product listed under this CAS number, including other names
2-Pyrimidinamine, 4-methyl-6-(1-piperidinyl)-, 98%, 98% (CAS 91717-22-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117QCV-250mg |
| cas | 91717-22-5 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 875.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-6-piperidin-1-ylpyrimidin-2-amine (CAS 91717-22-5) is a chemical compound with the molecular formula C10H16N4 and a molecular weight of 192.26 g/mol. IUPAC name: 4-methyl-6-piperidin-1-ylpyrimidin-2-amine. InChIKey: ZWVDHBALCSTSJN-UHFFFAOYSA-N.
| Molecular formula | C10H16N4 |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 4-methyl-6-piperidin-1-ylpyrimidin-2-amine |
| InChIKey | ZWVDHBALCSTSJN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N)N2CCCCC2 |
Computed by PubChem (NCBI)