CAS 123333-68-6 appears in our catalog under these names: 2-Sulfobenzoic acid hydrate, 96%, 2–Sulfobenzoic acid hydrate, 2-Sulfobenzoic acid hydrate, 98% , 2-SULFOBENZOIC ACID HYDRATE, ≥98%. Offered by: AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
2-sulfobenzoic acid;hydrate (CAS 123333-68-6) is a chemical compound with the molecular formula C7H8O6S and a molecular weight of 220.20 g/mol. IUPAC name: 2-sulfobenzoic acid;hydrate. InChIKey: HVJWSZOEEIYKSS-UHFFFAOYSA-N.
| Molecular formula | C7H8O6S |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 2-sulfobenzoic acid;hydrate |
| InChIKey | HVJWSZOEEIYKSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)O.O |
Computed by PubChem (NCBI)