cas: 1233143-48-0 — see every product listed under this CAS number, including other names
2-THIA-6-AZASPIRO[3.3]HEPTANE HEMIOXALATE, 97% (CAS 1233143-48-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467750-100MG |
| cas | 1233143-48-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1065.27 Pln | |
| Fluorochem | 5g | 3892.40 Pln | |
| Fluorochem | 10g | 6594.57 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Oxalic acid;bis(2-thia-6-azaspiro[3.3]heptane) (CAS 1233143-48-0) is a chemical compound with the molecular formula C12H20N2O4S2 and a molecular weight of 320.4 g/mol. IUPAC name: oxalic acid;bis(2-thia-6-azaspiro[3.3]heptane). InChIKey: IUOHIXFWUIKFFT-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O4S2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | oxalic acid;bis(2-thia-6-azaspiro[3.3]heptane) |
| InChIKey | IUOHIXFWUIKFFT-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CSC2.C1C2(CN1)CSC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)