cas: 99902-03-1 — see every product listed under this CAS number, including other names
2-Thiophen-3-yl-benzaldehyde, 95+%, 95+% (CAS 99902-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114VUU-100mg |
| cas | 99902-03-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1158.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-thiophen-3-ylbenzaldehyde (CAS 99902-03-1) is a chemical compound with the molecular formula C11H8OS and a molecular weight of 188.25 g/mol. IUPAC name: 2-thiophen-3-ylbenzaldehyde. InChIKey: ICLJIEBWQYGNIU-UHFFFAOYSA-N.
| Molecular formula | C11H8OS |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | 2-thiophen-3-ylbenzaldehyde |
| InChIKey | ICLJIEBWQYGNIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CSC=C2 |
Computed by PubChem (NCBI)