cas: 205371-27-3 — see every product listed under this CAS number, including other names
2-Tributylstannylpyrazine tech. (CAS 205371-27-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | 902595-250 |
| cas | 205371-27-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 332.82 Pln | |
| Chemat | 1g | 679.68 Pln |
| purity | tech. |
|---|---|
| delivery time | on request |
Tributyl(pyrazin-2-yl)stannane (CAS 205371-27-3) is a chemical compound with the molecular formula C16H30N2Sn and a molecular weight of 369.1 g/mol. IUPAC name: tributyl(pyrazin-2-yl)stannane. InChIKey: OVBXTKIWZAHFAC-UHFFFAOYSA-N.
| Molecular formula | C16H30N2Sn |
|---|---|
| Molecular weight | 369.1 g/mol |
| IUPAC name | tributyl(pyrazin-2-yl)stannane |
| InChIKey | OVBXTKIWZAHFAC-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=NC=CN=C1 |
Computed by PubChem (NCBI)