cas: 1889970-48-2 — see every product listed under this CAS number, including other names
2-amino-3-(2,4-dichlorophenyl)propanenitrile, 98%, 98% (CAS 1889970-48-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMP9-100mg |
| cas | 1889970-48-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 3165.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-(2,4-dichlorophenyl)propanenitrile (CAS 1889970-48-2) is a chemical compound with the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. IUPAC name: 2-amino-3-(2,4-dichlorophenyl)propanenitrile. InChIKey: FXVJGBOPURMEHC-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2 |
|---|---|
| Molecular weight | 215.08 g/mol |
| IUPAC name | 2-amino-3-(2,4-dichlorophenyl)propanenitrile |
| InChIKey | FXVJGBOPURMEHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC(C#N)N |
Computed by PubChem (NCBI)