cas: 61024-94-0 — see every product listed under this CAS number, including other names
2-bromo-4-(tert-butyl)-1-methylbenzene, 93%, 93% (CAS 61024-94-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EQJP-100mg |
| cas | 61024-94-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| Chemat | 10g | 2109.20 Pln |
| purity | 93% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-tert-butyl-1-methylbenzene (CAS 61024-94-0) is a chemical compound with the molecular formula C11H15Br and a molecular weight of 227.14 g/mol. IUPAC name: 2-bromo-4-tert-butyl-1-methylbenzene. InChIKey: VEIYGWKHCOGECS-UHFFFAOYSA-N.
| Molecular formula | C11H15Br |
|---|---|
| Molecular weight | 227.14 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-1-methylbenzene |
| InChIKey | VEIYGWKHCOGECS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(C)C)Br |
Computed by PubChem (NCBI)