2-chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine, 95%
cas: 1353553-07-7 — see every product listed under this CAS number, including other names
2-chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine, 95% (CAS 1353553-07-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F519249-100MG |
| cas | 1353553-07-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 500mg | 638.33 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Fluorochem | 5g | 2913.58 Pln | |
| Fluorochem | 10g | 4746.26 Pln | |
| Fluorochem | 25g | 9234.27 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 500mg | 386.00 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 1734.80 Pln | |
| Chemat | 10g | 2848.40 Pln | |
| Chemat | 25g | 5632.40 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine (CAS 1353553-07-7) is a chemical compound with the molecular formula C12H6ClN3O3S and a molecular weight of 307.71 g/mol. IUPAC name: 2-chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine. InChIKey: NZXIACCHHSKZIA-UHFFFAOYSA-N.
| Molecular formula | C12H6ClN3O3S |
|---|---|
| Molecular weight | 307.71 g/mol |
| IUPAC name | 2-chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine |
| InChIKey | NZXIACCHHSKZIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC(=NC3=C2SC=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)