2-octyldecanoic acid, 98%, 98%
cas: 619-39-6 — see every product listed under this CAS number, including other names
2-octyldecanoic acid, 98%, 98% (CAS 619-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EFFL-100mg |
| cas | 619-39-6 |
| size | 100mg |
| availability | 5000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 3851.60 Pln | |
| Chemat | 250g | 4542.80 Pln | |
| Chemat | 500g | 6336.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-octyldecanoic acid (CAS 619-39-6) is a chemical compound with the molecular formula C18H36O2 and a molecular weight of 284.5 g/mol. IUPAC name: 2-octyldecanoic acid. InChIKey: OYYXZGFIZTYYRB-UHFFFAOYSA-N.
| Molecular formula | C18H36O2 |
|---|---|
| Molecular weight | 284.5 g/mol |
| IUPAC name | 2-octyldecanoic acid |
| InChIKey | OYYXZGFIZTYYRB-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)O |
Computed by PubChem (NCBI)