cas: 1820647-12-8 — see every product listed under this CAS number, including other names
2-tert-Butoxycarbonylamino-4,5,6,7-tetrahydro-benzothiazole-6-carboxylic acid ethyl ester, 97%, 97% (CAS 1820647-12-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I1NC-100mg |
| cas | 1820647-12-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 357.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate (CAS 1820647-12-8) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate. InChIKey: GVLNPESDGWKYEA-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate |
| InChIKey | GVLNPESDGWKYEA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC2=C(C1)SC(=N2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)