cas: 274905-73-6 — see every product listed under this CAS number, including other names
2-tert-Butyl-9,10-di(2-naphthyl)anthracene, 95-<97% (CAS 274905-73-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC632-95-97-5g |
| cas | 274905-73-6 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 3172.62 Pln | |
| Hoffman Fine Chemicals | 10g | 4754.86 Pln | |
| Hoffman Fine Chemicals | 25g | 9195.34 Pln | |
| Hoffman Fine Chemicals | 50g | 14529.02 Pln | |
| Hoffman Fine Chemicals | 100g | 23059.08 Pln | |
| Hoffman Fine Chemicals | 200g | 38983.56 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-tert-butyl-9,10-dinaphthalen-2-ylanthracene (CAS 274905-73-6) is a chemical compound with the molecular formula C38H30 and a molecular weight of 486.6 g/mol. IUPAC name: 2-tert-butyl-9,10-dinaphthalen-2-ylanthracene. InChIKey: OBAJPWYDYFEBTF-UHFFFAOYSA-N.
| Molecular formula | C38H30 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | 2-tert-butyl-9,10-dinaphthalen-2-ylanthracene |
| InChIKey | OBAJPWYDYFEBTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)