21-Hydroxyhenicosanoic acid, 98%
cas: 89160-04-3 — see every product listed under this CAS number, including other names
21-Hydroxyhenicosanoic acid, 98% (CAS 89160-04-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1195099-250mg |
| cas | 89160-04-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1410.56 Pln | |
| Ambeed | 25g | 4809.25 Pln | |
| Ambeed | 100g | 16312.50 Pln | |
| BLDpharm | 250mg | 264.38 Pln | |
| BLDpharm | 1g | 475.41 Pln | |
| BLDpharm | 5g | 1513.94 Pln | |
| BLDpharm | 25g | 5184.87 Pln | |
| BLDpharm | 100g | 17580.50 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1197.20 Pln | |
| Chemat | 25g | 4034.00 Pln | |
| Fluorochem | 250mg | 242.64 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1450.55 Pln | |
| Fluorochem | 25g | 4918.08 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
21-hydroxyhenicosanoic acid is an -hydroxy-long-chain fatty acid that is henicosanoic acid in which one of the hydrogens of the terminal methyl group has been replaced by a hydroxy group. It is an omega-hydroxy-long-chain fatty acid and a straight-chain saturated fatty acid. It is functionally related to a henicosanoic acid. It is a conjugate acid of a 21-hydroxyhenicosanoate.
Source: ChEBI
| Molecular formula | C21H42O3 |
|---|---|
| Molecular weight | 342.6 g/mol |
| IUPAC name | 21-hydroxyhenicosanoic acid |
| InChIKey | NENJNFMRWQAPAC-UHFFFAOYSA-N |
| SMILES | C(CCCCCCCCCCO)CCCCCCCCCC(=O)O |
Computed by PubChem (NCBI)