cas: 1334177-79-5 — see every product listed under this CAS number, including other names
25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid, 95%, 95% (CAS 1334177-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110IT9-100mg |
| cas | 1334177-79-5 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 851.60 Pln | |
| Chemat | 5g | 2819.60 Pln | |
| Chemat | 25g | 9717.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334177-79-5) is a chemical compound with the molecular formula C22H36N2O11 and a molecular weight of 504.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: WKTGEZMXNNBFEZ-UHFFFAOYSA-N.
| Molecular formula | C22H36N2O11 |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | WKTGEZMXNNBFEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)