29-Amino-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol, 98%, 98%
cas: 129449-09-8 — see every product listed under this CAS number, including other names
29-Amino-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol, 98%, 98% (CAS 129449-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111Z5Z-100mg |
| cas | 129449-09-8 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 2613.20 Pln | |
| Chemat | 10g | 4197.20 Pln | |
| Chemat | 25g | 6952.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 129449-09-8) is a chemical compound with the molecular formula C20H43NO10 and a molecular weight of 457.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: OXOVKDXWDUGJLC-UHFFFAOYSA-N.
| Molecular formula | C20H43NO10 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | OXOVKDXWDUGJLC-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCO)N |
Computed by PubChem (NCBI)
Synonyms:
Amino-PEG10-alcohol, Amino-PEG10-OH, 29-amino-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol, 3,6,9,12,15,18,21,24,27-Nonaoxanonacosan-1-ol, 29-amino-, Amino-PEG-10-alcohol, orb1989575, OXOVKDXWDUGJLC-UHFFFAOYSA-N, 29-amino-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol, H2N-PEG10-OH/3,6,9,12,15,18,21,24,27-Nonaoxanonacosan-1-ol, 29-amino-