3'-Hexyl-[2,2'-bithiophene]-5-carbaldehyde, 98%
cas: 1309383-35-4 — see every product listed under this CAS number, including other names
3'-Hexyl-[2,2'-bithiophene]-5-carbaldehyde, 98% (CAS 1309383-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1474031-100mg |
| cas | 1309383-35-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1260.38 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 553.16 Pln | |
| BLDpharm | 1g | 1352.88 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1518.80 Pln | |
| Fluorochem | 100mg | 747.67 Pln | |
| Fluorochem | 250mg | 1143.37 Pln | |
| Fluorochem | 1g | 2825.06 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-(3-hexylthiophen-2-yl)thiophene-2-carbaldehyde (CAS 1309383-35-4) is a chemical compound with the molecular formula C15H18OS2 and a molecular weight of 278.4 g/mol. IUPAC name: 5-(3-hexylthiophen-2-yl)thiophene-2-carbaldehyde. InChIKey: BNCXZWMQXJGANL-UHFFFAOYSA-N.
| Molecular formula | C15H18OS2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 5-(3-hexylthiophen-2-yl)thiophene-2-carbaldehyde |
| InChIKey | BNCXZWMQXJGANL-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=C(SC=C1)C2=CC=C(S2)C=O |
Computed by PubChem (NCBI)