3'-O-(T-BUTYLDIMETHYLSILYL)-2'-O-METHYLURIDINE, 98%, 98%
cas: 171268-84-1 — see every product listed under this CAS number, including other names
3'-O-(T-BUTYLDIMETHYLSILYL)-2'-O-METHYLURIDINE, 98%, 98% (CAS 171268-84-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQMS-100mg |
| cas | 171268-84-1 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 500mg | 107.60 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1110.80 Pln | |
| Chemat | 50g | 2080.40 Pln | |
| Chemat | 100g | 3683.60 Pln | |
| Chemat | 250g | 7437.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione (CAS 171268-84-1) is a chemical compound with the molecular formula C16H28N2O6Si and a molecular weight of 372.49 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: VWMFRWSCFRRALN-FMKGYKFTSA-N.
| Molecular formula | C16H28N2O6Si |
|---|---|
| Molecular weight | 372.49 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | VWMFRWSCFRRALN-FMKGYKFTSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[C@H]([C@@H]1OC)N2C=CC(=O)NC2=O)CO |
Computed by PubChem (NCBI)