3,11-Dichloro-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepine 5,5-dioxide, 95%
cas: 26638-66-4 — see every product listed under this CAS number, including other names
3,11-Dichloro-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepine 5,5-dioxide, 95% (CAS 26638-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A715746-1g |
| cas | 26638-66-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 348.12 Pln | |
| Ambeed | 25g | 620.69 Pln | |
| Ambeed | 100g | 1833.31 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 424.40 Pln | |
| Chemat | 100g | 1173.20 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 236.61 Pln | |
| BLDpharm | 10g | 342.13 Pln | |
| BLDpharm | 25g | 614.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3,11-dichloro-6-methyl-11H-benzo[c][2,1]benzothiazepine 5,5-dioxide (CAS 26638-66-4) is a chemical compound with the molecular formula C14H11Cl2NO2S and a molecular weight of 328.2 g/mol. IUPAC name: 3,11-dichloro-6-methyl-11H-benzo[c][2,1]benzothiazepine 5,5-dioxide. InChIKey: FHICZIHQHGRZLE-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO2S |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 3,11-dichloro-6-methyl-11H-benzo[c][2,1]benzothiazepine 5,5-dioxide |
| InChIKey | FHICZIHQHGRZLE-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(C3=C(S1(=O)=O)C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
3,11-dichloro-6,11-dihydro-6-methyldibenzo[c,f][1,2]thiazepine 5,5-dioxide, 3,11-Dichloro-6,11-dihydro-6-methyldibenzo(c,f)(1,2)thiazepine 5,5-dioxide, 3,11-Dichloro-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepine 5,5-dioxide, 3,11-Dichloro-6,11-dihydro-6-methyl-5,5-dioxodibenzo[c,f][1,2]thiazepine, C14H11Cl2NO2S, rac 3,11-Dichloro-6,11-dihydro-6-methyl-dibenzo[c,f][1,2]thiazepine 5,5-Dioxide, 3,11-dichloro-6-methyl-11H-benzo[c][2,1]benzothiazepine 5,5-dioxide, Dibenzo[c,f][1,2]thiazepine,3,11-dichloro-6,11-dihydro-6-methyl-,5,5-dioxide, Tianeptine intermediate, Tianeptine InterMediate (the ninth step)