3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl acrylate, 95% (stabilized with MEHQ or TBC)
cas: 17527-29-6 — see every product listed under this CAS number, including other names
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl acrylate, 95% (stabilized with MEHQ or TBC) (CAS 17527-29-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A137864-5g |
| cas | 17527-29-6 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 181.25 Pln | |
| Ambeed | 100g | 437.12 Pln | |
| Ambeed | 500g | 1850.00 Pln | |
| Ambeed | 1kg | 3613.31 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 136.64 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 430.98 Pln | |
| BLDpharm | 500g | 1808.28 Pln | |
| BLDpharm | 1kg | 3546.55 Pln |
properties
| purity | 95% (stabilized with MEHQ or TBC) |
|---|---|
| delivery time | 1-2 weeks |
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate (CAS 17527-29-6) is a chemical compound with the molecular formula C11H7F13O2 and a molecular weight of 418.15 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate. InChIKey: VPKQPPJQTZJZDB-UHFFFAOYSA-N.
| Molecular formula | C11H7F13O2 |
|---|---|
| Molecular weight | 418.15 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate |
| InChIKey | VPKQPPJQTZJZDB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
1h,1h,2h,2h-perfluorooctyl acrylate, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl acrylate, perfluorohexylethyl acrylate, 2-(Perfluorohexyl)ethyl acrylate, 2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester, 1,1,2,2-Tetrahydroperfluorooctyl acrylate, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate, (perfluorohexyl)ethyl acrylate, 1H,1H,2H,2H-Tridecafluoro-n-octyl Acrylate, 1H,1H,2H,2H-Tridecafluoro-n-octyl Acrylate (stabilized with HQ + MEHQ)