CAS 30670-30-5 appears in our catalog under these names: 1H,1H,2H,2H-Perfluorodecylamine, 1H,1H,2H,2H–Perfluorodecylamine, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecan-1-amine, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 500mg, 50mg, 1g, 250mg, 5g, 2g.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-1-amine (CAS 30670-30-5) is a chemical compound with the molecular formula C10H6F17N and a molecular weight of 463.13 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-1-amine. InChIKey: PFINVJYJNJHTFY-UHFFFAOYSA-N.
| Molecular formula | C10H6F17N |
|---|---|
| Molecular weight | 463.13 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-1-amine |
| InChIKey | PFINVJYJNJHTFY-UHFFFAOYSA-N |
| SMILES | C(CN)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)