cas: 50662-95-8 — see every product listed under this CAS number, including other names
3,4'-Oxydiphthalic Anhydride 98% (CAS 50662-95-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A865955-1g |
| cas | 50662-95-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2061.38 Pln | |
| Ambeed | 100g | 4052.75 Pln | |
| Ambeed | 500g | 15989.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A865955 |
4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione (CAS 50662-95-8) is a chemical compound with the molecular formula C16H6O7 and a molecular weight of 310.21 g/mol. IUPAC name: 4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione. InChIKey: OPVHOFITDJSMOD-UHFFFAOYSA-N.
| Molecular formula | C16H6O7 |
|---|---|
| Molecular weight | 310.21 g/mol |
| IUPAC name | 4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione |
| InChIKey | OPVHOFITDJSMOD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OC3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
Computed by PubChem (NCBI)