cas: 53317-05-8 — see every product listed under this CAS number, including other names
3,4,5-Tribromo-2-thiophenecarboxylic acid 95% (CAS 53317-05-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A725712-100mg |
| cas | 53317-05-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1877.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A725712 |
3,4,5-tribromothiophene-2-carboxylic acid (CAS 53317-05-8) is a chemical compound with the molecular formula C5HBr3O2S and a molecular weight of 364.84 g/mol. IUPAC name: 3,4,5-tribromothiophene-2-carboxylic acid. InChIKey: QEZRPOCNDKTQJO-UHFFFAOYSA-N.
| Molecular formula | C5HBr3O2S |
|---|---|
| Molecular weight | 364.84 g/mol |
| IUPAC name | 3,4,5-tribromothiophene-2-carboxylic acid |
| InChIKey | QEZRPOCNDKTQJO-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=C1Br)Br)C(=O)O)Br |
Computed by PubChem (NCBI)